C12H18F2N4O — CID 106241605
5-[[6-(ethylamino)-3,5-difluoro-2-pyridinyl]amino]pentanamide (PubChem CID 106241605) has the molecular formula C12H18F2N4O and a molecular weight of 272.30 g/mol. Its IUPAC name is 5-[[6-(ethylamino)-3,5-difluoro-2-pyridinyl]amino]pentanamide.
| Compound Name | 5-[[6-(ethylamino)-3,5-difluoro-2-pyridinyl]amino]pentanamide |
|---|---|
| PubChem CID | 106241605 |
| Molecular Formula | C12H18F2N4O |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 5-[[6-(ethylamino)-3,5-difluoro-2-pyridinyl]amino]pentanamide |
| SMILES | CCNc1nc(NCCCCC(N)=O)c(F)cc1F |
| InChI | InChI=1S/C12H18F2N4O/c1-2-16-11-8(13)7-9(14)12(18-11)17-6-4-3-5-10(15)19/h7H,2-6H2,1H3,(H2,15,19)(H2,16,17,18) |
| InChIKey | SUEVYQKMWGSVMP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|