C13H21F2N3 — CID 114074590
3,5-difluoro-6-N-octylpyridine-2,6-diamine (PubChem CID 114074590) has the molecular formula C13H21F2N3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3,5-difluoro-6-N-octylpyridine-2,6-diamine.
| Compound Name | 3,5-difluoro-6-N-octylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 114074590 |
| Molecular Formula | C13H21F2N3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 3,5-difluoro-6-N-octylpyridine-2,6-diamine |
| SMILES | CCCCCCCCNc1nc(N)c(F)cc1F |
| InChI | InChI=1S/C13H21F2N3/c1-2-3-4-5-6-7-8-17-13-11(15)9-10(14)12(16)18-13/h9H,2-8H2,1H3,(H3,16,17,18) |
| InChIKey | NTEIKJFTWYRBFZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|