C13H20F2N4O — CID 106241585
5-[[3,5-difluoro-6-(propylamino)-2-pyridinyl]amino]pentanamide (PubChem CID 106241585) has the molecular formula C13H20F2N4O and a molecular weight of 286.33 g/mol. Its IUPAC name is 5-[[3,5-difluoro-6-(propylamino)-2-pyridinyl]amino]pentanamide.
| Compound Name | 5-[[3,5-difluoro-6-(propylamino)-2-pyridinyl]amino]pentanamide |
|---|---|
| PubChem CID | 106241585 |
| Molecular Formula | C13H20F2N4O |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 5-[[3,5-difluoro-6-(propylamino)-2-pyridinyl]amino]pentanamide |
| SMILES | CCCNc1nc(NCCCCC(N)=O)c(F)cc1F |
| InChI | InChI=1S/C13H20F2N4O/c1-2-6-17-12-9(14)8-10(15)13(19-12)18-7-4-3-5-11(16)20/h8H,2-7H2,1H3,(H2,16,20)(H2,17,18,19) |
| InChIKey | QFLMPVCNBKMSDF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|