C11H13F6N3 — CID 106296104
3,5-difluoro-2-N-propyl-6-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,6-diamine (PubChem CID 106296104) has the molecular formula C11H13F6N3 and a molecular weight of 301.23 g/mol. Its IUPAC name is 3,5-difluoro-2-N-propyl-6-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,6-diamine.
| Compound Name | 3,5-difluoro-2-N-propyl-6-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 106296104 |
| Molecular Formula | C11H13F6N3 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3,5-difluoro-2-N-propyl-6-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,6-diamine |
| SMILES | CCCNc1nc(NCC(F)(F)C(F)F)c(F)cc1F |
| InChI | InChI=1S/C11H13F6N3/c1-2-3-18-8-6(12)4-7(13)9(20-8)19-5-11(16,17)10(14)15/h4,10H,2-3,5H2,1H3,(H2,18,19,20) |
| InChIKey | IRLQXIDJQLRLHX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|