C13H12F4N2 — CID 106293889
3-methyl-N-(2,2,3,3-tetrafluoropropyl)quinolin-2-amine (PubChem CID 106293889) has the molecular formula C13H12F4N2 and a molecular weight of 272.25 g/mol. Its IUPAC name is 3-methyl-N-(2,2,3,3-tetrafluoropropyl)quinolin-2-amine.
| Compound Name | 3-methyl-N-(2,2,3,3-tetrafluoropropyl)quinolin-2-amine |
|---|---|
| PubChem CID | 106293889 |
| Molecular Formula | C13H12F4N2 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3-methyl-N-(2,2,3,3-tetrafluoropropyl)quinolin-2-amine |
| SMILES | Cc1cc2ccccc2nc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H12F4N2/c1-8-6-9-4-2-3-5-10(9)19-11(8)18-7-13(16,17)12(14)15/h2-6,12H,7H2,1H3,(H,18,19) |
| InChIKey | KXZMFNZUEYJDDV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|