C17H24N2O — CID 106350873
4,4-dimethyl-3-[(3-methylquinolin-2-yl)amino]pentan-1-ol (PubChem CID 106350873) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 4,4-dimethyl-3-[(3-methylquinolin-2-yl)amino]pentan-1-ol.
| Compound Name | 4,4-dimethyl-3-[(3-methylquinolin-2-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 106350873 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 4,4-dimethyl-3-[(3-methylquinolin-2-yl)amino]pentan-1-ol |
| SMILES | Cc1cc2ccccc2nc1NC(CCO)C(C)(C)C |
| InChI | InChI=1S/C17H24N2O/c1-12-11-13-7-5-6-8-14(13)18-16(12)19-15(9-10-20)17(2,3)4/h5-8,11,15,20H,9-10H2,1-4H3,(H,18,19) |
| InChIKey | CLUZWACEGUKARY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |