C9H12F4N4 — CID 106296095
2-N,5-dimethyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine (PubChem CID 106296095) has the molecular formula C9H12F4N4 and a molecular weight of 252.22 g/mol. Its IUPAC name is 2-N,5-dimethyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,5-dimethyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106296095 |
| Molecular Formula | C9H12F4N4 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-N,5-dimethyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine |
| SMILES | CNc1ncc(C)c(NCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C9H12F4N4/c1-5-3-15-8(14-2)17-6(5)16-4-9(12,13)7(10)11/h3,7H,4H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | JQMAIBXPENPXBC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|