C10H16N4O2 — CID 80789523
ethyl 2-[[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]acetate (PubChem CID 80789523) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is ethyl 2-[[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]acetate.
| Compound Name | ethyl 2-[[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 80789523 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | ethyl 2-[[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1nc(NC)ncc1C |
| InChI | InChI=1S/C10H16N4O2/c1-4-16-8(15)6-12-9-7(2)5-13-10(11-3)14-9/h5H,4,6H2,1-3H3,(H2,11,12,13,14) |
| InChIKey | JQHFBIYORCRQST-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |