C8H14N4O2 — CID 114995528
ethyl 2-[(5-amino-2-methyl-1H-imidazol-4-yl)amino]acetate (PubChem CID 114995528) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is ethyl 2-[(5-amino-2-methyl-1H-imidazol-4-yl)amino]acetate.
| Compound Name | ethyl 2-[(5-amino-2-methyl-1H-imidazol-4-yl)amino]acetate |
|---|---|
| PubChem CID | 114995528 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | ethyl 2-[(5-amino-2-methyl-1H-imidazol-4-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1nc(C)[nH]c1N |
| InChI | InChI=1S/C8H14N4O2/c1-3-14-6(13)4-10-8-7(9)11-5(2)12-8/h10H,3-4,9H2,1-2H3,(H,11,12) |
| InChIKey | DUJWOQQRKUVCLB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |