C7H13N5O — CID 82239157
3-[(5-amino-2-methyl-1H-imidazol-4-yl)amino]propanamide (PubChem CID 82239157) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 3-[(5-amino-2-methyl-1H-imidazol-4-yl)amino]propanamide.
| Compound Name | 3-[(5-amino-2-methyl-1H-imidazol-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 82239157 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 3-[(5-amino-2-methyl-1H-imidazol-4-yl)amino]propanamide |
| SMILES | Cc1nc(NCCC(N)=O)c(N)[nH]1 |
| InChI | InChI=1S/C7H13N5O/c1-4-11-6(9)7(12-4)10-3-2-5(8)13/h10H,2-3,9H2,1H3,(H2,8,13)(H,11,12) |
| InChIKey | RIDRFBMSWFREBP-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |