C8H12ClN5O — CID 80787750
3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]propanamide (PubChem CID 80787750) has the molecular formula C8H12ClN5O and a molecular weight of 229.67 g/mol. Its IUPAC name is 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]propanamide.
| Compound Name | 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 80787750 |
| Molecular Formula | C8H12ClN5O |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]propanamide |
| SMILES | CNc1ncc(Cl)c(NCCC(N)=O)n1 |
| InChI | InChI=1S/C8H12ClN5O/c1-11-8-13-4-5(9)7(14-8)12-3-2-6(10)15/h4H,2-3H2,1H3,(H2,10,15)(H2,11,12,13,14) |
| InChIKey | FLMOODWXHWINGH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |