C8H13ClN6O — CID 80903270
3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]-N-methylpropanamide (PubChem CID 80903270) has the molecular formula C8H13ClN6O and a molecular weight of 244.69 g/mol. Its IUPAC name is 3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]-N-methylpropanamide.
| Compound Name | 3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 80903270 |
| Molecular Formula | C8H13ClN6O |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)CCNc1nc(NN)ncc1Cl |
| InChI | InChI=1S/C8H13ClN6O/c1-11-6(16)2-3-12-7-5(9)4-13-8(14-7)15-10/h4H,2-3,10H2,1H3,(H,11,16)(H2,12,13,14,15) |
| InChIKey | NIWGUNPAPPNGPN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|