C8H14ClN5S — CID 80913327
5-chloro-2-hydrazinyl-N-(3-methylsulfanylpropyl)pyrimidin-4-amine (PubChem CID 80913327) has the molecular formula C8H14ClN5S and a molecular weight of 247.75 g/mol. Its IUPAC name is 5-chloro-2-hydrazinyl-N-(3-methylsulfanylpropyl)pyrimidin-4-amine.
| Compound Name | 5-chloro-2-hydrazinyl-N-(3-methylsulfanylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80913327 |
| Molecular Formula | C8H14ClN5S |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 5-chloro-2-hydrazinyl-N-(3-methylsulfanylpropyl)pyrimidin-4-amine |
| SMILES | CSCCCNc1nc(NN)ncc1Cl |
| InChI | InChI=1S/C8H14ClN5S/c1-15-4-2-3-11-7-6(9)5-12-8(13-7)14-10/h5H,2-4,10H2,1H3,(H2,11,12,13,14) |
| InChIKey | AIFSDGKBNURQHU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|