C7H11ClFN5 — CID 130505153
5-chloro-N-(3-fluoropropyl)-2-hydrazinylpyrimidin-4-amine (PubChem CID 130505153) has the molecular formula C7H11ClFN5 and a molecular weight of 219.65 g/mol. Its IUPAC name is 5-chloro-N-(3-fluoropropyl)-2-hydrazinylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-(3-fluoropropyl)-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 130505153 |
| Molecular Formula | C7H11ClFN5 |
| Molecular Weight | 219.65 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 5-chloro-N-(3-fluoropropyl)-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1ncc(Cl)c(NCCCF)n1 |
| InChI | InChI=1S/C7H11ClFN5/c8-5-4-12-7(14-10)13-6(5)11-3-1-2-9/h4H,1-3,10H2,(H2,11,12,13,14) |
| InChIKey | DGEIPMYHYMKUTM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.65 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|