C6H8ClFN4 — CID 130505088
5-chloro-4-N-(2-fluoroethyl)pyrimidine-2,4-diamine (PubChem CID 130505088) has the molecular formula C6H8ClFN4 and a molecular weight of 190.61 g/mol. Its IUPAC name is 5-chloro-4-N-(2-fluoroethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-fluoroethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 130505088 |
| Molecular Formula | C6H8ClFN4 |
| Molecular Weight | 190.61 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 5-chloro-4-N-(2-fluoroethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Cl)c(NCCF)n1 |
| InChI | InChI=1S/C6H8ClFN4/c7-4-3-11-6(9)12-5(4)10-2-1-8/h3H,1-2H2,(H3,9,10,11,12) |
| InChIKey | UDUPFAWMGYCOLU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.61 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |