C7H11ClN6O — CID 83117242
2-[(2-amino-5-chloropyrimidin-4-yl)amino]ethylurea (PubChem CID 83117242) has the molecular formula C7H11ClN6O and a molecular weight of 230.66 g/mol. Its IUPAC name is 2-[(2-amino-5-chloropyrimidin-4-yl)amino]ethylurea.
| Compound Name | 2-[(2-amino-5-chloropyrimidin-4-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83117242 |
| Molecular Formula | C7H11ClN6O |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-[(2-amino-5-chloropyrimidin-4-yl)amino]ethylurea |
| SMILES | NC(=O)NCCNc1nc(N)ncc1Cl |
| InChI | InChI=1S/C7H11ClN6O/c8-4-3-13-6(9)14-5(4)11-1-2-12-7(10)15/h3H,1-2H2,(H3,10,12,15)(H3,9,11,13,14) |
| InChIKey | MCTQXAGDDJHGDP-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|