C9H13ClN4 — CID 80783168
5-chloro-4-N-(cyclobutylmethyl)pyrimidine-2,4-diamine (PubChem CID 80783168) has the molecular formula C9H13ClN4 and a molecular weight of 212.68 g/mol. Its IUPAC name is 5-chloro-4-N-(cyclobutylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(cyclobutylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80783168 |
| Molecular Formula | C9H13ClN4 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 5-chloro-4-N-(cyclobutylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Cl)c(NCC2CCC2)n1 |
| InChI | InChI=1S/C9H13ClN4/c10-7-5-13-9(11)14-8(7)12-4-6-2-1-3-6/h5-6H,1-4H2,(H3,11,12,13,14) |
| InChIKey | ZEGZOOYATOKKBE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |