C10H15FN4O — CID 80813012
5-fluoro-4-N-(oxan-3-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 80813012) has the molecular formula C10H15FN4O and a molecular weight of 226.25 g/mol. Its IUPAC name is 5-fluoro-4-N-(oxan-3-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-4-N-(oxan-3-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80813012 |
| Molecular Formula | C10H15FN4O |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 5-fluoro-4-N-(oxan-3-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(F)c(NCC2CCCOC2)n1 |
| InChI | InChI=1S/C10H15FN4O/c11-8-5-14-10(12)15-9(8)13-4-7-2-1-3-16-6-7/h5,7H,1-4,6H2,(H3,12,13,14,15) |
| InChIKey | JHYBNTKYXLSBIE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |