C8H14N4OS — CID 66281185
5-N-(oxan-3-ylmethyl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 66281185) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is 5-N-(oxan-3-ylmethyl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-(oxan-3-ylmethyl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 66281185 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 5-N-(oxan-3-ylmethyl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | Nc1nsc(NCC2CCCOC2)n1 |
| InChI | InChI=1S/C8H14N4OS/c9-7-11-8(14-12-7)10-4-6-2-1-3-13-5-6/h6H,1-5H2,(H3,9,10,11,12) |
| InChIKey | CKBLNCCKISNWLG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |