C9H12ClN7O — CID 106424726
5-chloro-2-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyrimidin-4-amine (PubChem CID 106424726) has the molecular formula C9H12ClN7O and a molecular weight of 269.70 g/mol. Its IUPAC name is 5-chloro-2-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-2-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106424726 |
| Molecular Formula | C9H12ClN7O |
| Molecular Weight | 269.70 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 5-chloro-2-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyrimidin-4-amine |
| SMILES | Cc1nc(CCNc2nc(NN)ncc2Cl)no1 |
| InChI | InChI=1S/C9H12ClN7O/c1-5-14-7(17-18-5)2-3-12-8-6(10)4-13-9(15-8)16-11/h4H,2-3,11H2,1H3,(H2,12,13,15,16) |
| InChIKey | AQZVHYGQCOBANB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.70 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|