C8H10ClN7O — CID 80903865
5-chloro-2-hydrazinyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrimidin-4-amine (PubChem CID 80903865) has the molecular formula C8H10ClN7O and a molecular weight of 255.67 g/mol. Its IUPAC name is 5-chloro-2-hydrazinyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-2-hydrazinyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80903865 |
| Molecular Formula | C8H10ClN7O |
| Molecular Weight | 255.67 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 5-chloro-2-hydrazinyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1noc(CNc2nc(NN)ncc2Cl)n1 |
| InChI | InChI=1S/C8H10ClN7O/c1-4-13-6(17-16-4)3-11-7-5(9)2-12-8(14-7)15-10/h2H,3,10H2,1H3,(H2,11,12,14,15) |
| InChIKey | LGOBNQXPHPJUCH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.67 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|