C11H14ClN5S — CID 80930673
5-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-hydrazinylpyrimidin-4-amine (PubChem CID 80930673) has the molecular formula C11H14ClN5S and a molecular weight of 283.79 g/mol. Its IUPAC name is 5-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-hydrazinylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80930673 |
| Molecular Formula | C11H14ClN5S |
| Molecular Weight | 283.79 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-hydrazinylpyrimidin-4-amine |
| SMILES | Cc1cc(CNc2nc(NN)ncc2Cl)sc1C |
| InChI | InChI=1S/C11H14ClN5S/c1-6-3-8(18-7(6)2)4-14-10-9(12)5-15-11(16-10)17-13/h3,5H,4,13H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | ZPBHAPAXIJDSTG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|