C9H16ClN5O — CID 115366625
3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]-2,2-dimethylpropan-1-ol (PubChem CID 115366625) has the molecular formula C9H16ClN5O and a molecular weight of 245.71 g/mol. Its IUPAC name is 3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 115366625 |
| Molecular Formula | C9H16ClN5O |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)CNc1nc(NN)ncc1Cl |
| InChI | InChI=1S/C9H16ClN5O/c1-9(2,5-16)4-13-7-6(10)3-12-8(14-7)15-11/h3,16H,4-5,11H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | LXJZUQRKABYJFH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|