C13H22ClN5O — CID 80819644
N-butan-2-yl-3-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]propanamide (PubChem CID 80819644) has the molecular formula C13H22ClN5O and a molecular weight of 299.81 g/mol. Its IUPAC name is N-butan-2-yl-3-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]propanamide.
| Compound Name | N-butan-2-yl-3-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 80819644 |
| Molecular Formula | C13H22ClN5O |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-butan-2-yl-3-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]propanamide |
| SMILES | CCNc1ncc(Cl)c(NCCC(=O)NC(C)CC)n1 |
| InChI | InChI=1S/C13H22ClN5O/c1-4-9(3)18-11(20)6-7-16-12-10(14)8-17-13(19-12)15-5-2/h8-9H,4-7H2,1-3H3,(H,18,20)(H2,15,16,17,19) |
| InChIKey | MSSCVDBXKQDSIJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |