C11H18ClN5O — CID 106347504
2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]-3-methylbutanamide (PubChem CID 106347504) has the molecular formula C11H18ClN5O and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]-3-methylbutanamide.
| Compound Name | 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106347504 |
| Molecular Formula | C11H18ClN5O |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]-3-methylbutanamide |
| SMILES | CCNc1ncc(Cl)c(NC(C(N)=O)C(C)C)n1 |
| InChI | InChI=1S/C11H18ClN5O/c1-4-14-11-15-5-7(12)10(17-11)16-8(6(2)3)9(13)18/h5-6,8H,4H2,1-3H3,(H2,13,18)(H2,14,15,16,17) |
| InChIKey | XMIYCEXXJFFJIY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |