C12H21ClN4 — CID 80822478
5-chloro-2-N-ethyl-4-N-hexan-2-ylpyrimidine-2,4-diamine (PubChem CID 80822478) has the molecular formula C12H21ClN4 and a molecular weight of 256.78 g/mol. Its IUPAC name is 5-chloro-2-N-ethyl-4-N-hexan-2-ylpyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-ethyl-4-N-hexan-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80822478 |
| Molecular Formula | C12H21ClN4 |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 5-chloro-2-N-ethyl-4-N-hexan-2-ylpyrimidine-2,4-diamine |
| SMILES | CCCCC(C)Nc1nc(NCC)ncc1Cl |
| InChI | InChI=1S/C12H21ClN4/c1-4-6-7-9(3)16-11-10(13)8-15-12(17-11)14-5-2/h8-9H,4-7H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | ZBYCVNBZHVJDSQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |