C12H20ClN5O — CID 80801182
2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]-N-propylpropanamide (PubChem CID 80801182) has the molecular formula C12H20ClN5O and a molecular weight of 285.78 g/mol. Its IUPAC name is 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]-N-propylpropanamide.
| Compound Name | 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 80801182 |
| Molecular Formula | C12H20ClN5O |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)Nc1nc(NCC)ncc1Cl |
| InChI | InChI=1S/C12H20ClN5O/c1-4-6-15-11(19)8(3)17-10-9(13)7-16-12(18-10)14-5-2/h7-8H,4-6H2,1-3H3,(H,15,19)(H2,14,16,17,18) |
| InChIKey | SIQXWZKWSLFLPE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |