C9H14ClN5O — CID 80786812
2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]propanamide (PubChem CID 80786812) has the molecular formula C9H14ClN5O and a molecular weight of 243.70 g/mol. Its IUPAC name is 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]propanamide.
| Compound Name | 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 80786812 |
| Molecular Formula | C9H14ClN5O |
| Molecular Weight | 243.70 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-[[5-chloro-2-(ethylamino)pyrimidin-4-yl]amino]propanamide |
| SMILES | CCNc1ncc(Cl)c(NC(C)C(N)=O)n1 |
| InChI | InChI=1S/C9H14ClN5O/c1-3-12-9-13-4-6(10)8(15-9)14-5(2)7(11)16/h4-5H,3H2,1-2H3,(H2,11,16)(H2,12,13,14,15) |
| InChIKey | HHCDBNGLHDUQIT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.70 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |