C8H9Cl2N3O2 — CID 79632906
methyl 2-[(2,5-dichloropyrimidin-4-yl)amino]propanoate (PubChem CID 79632906) has the molecular formula C8H9Cl2N3O2 and a molecular weight of 250.08 g/mol. Its IUPAC name is methyl 2-[(2,5-dichloropyrimidin-4-yl)amino]propanoate.
| Compound Name | methyl 2-[(2,5-dichloropyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 79632906 |
| Molecular Formula | C8H9Cl2N3O2 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | methyl 2-[(2,5-dichloropyrimidin-4-yl)amino]propanoate |
| SMILES | COC(=O)C(C)Nc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C8H9Cl2N3O2/c1-4(7(14)15-2)12-6-5(9)3-11-8(10)13-6/h3-4H,1-2H3,(H,11,12,13) |
| InChIKey | YZOVRTQMIAJKFL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |