C11H16Cl2N4O — CID 113408737
2-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-diethylpropanamide (PubChem CID 113408737) has the molecular formula C11H16Cl2N4O and a molecular weight of 291.18 g/mol. Its IUPAC name is 2-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-diethylpropanamide.
| Compound Name | 2-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 113408737 |
| Molecular Formula | C11H16Cl2N4O |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Nc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C11H16Cl2N4O/c1-4-17(5-2)10(18)7(3)15-9-8(12)6-14-11(13)16-9/h6-7H,4-5H2,1-3H3,(H,14,15,16) |
| InChIKey | AOCLMAGZNFNTOX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |