C12H19F2N5O — CID 114073557
2-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylpropanamide (PubChem CID 114073557) has the molecular formula C12H19F2N5O and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylpropanamide.
| Compound Name | 2-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 114073557 |
| Molecular Formula | C12H19F2N5O |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Nc1nc(NN)c(F)cc1F |
| InChI | InChI=1S/C12H19F2N5O/c1-4-19(5-2)12(20)7(3)16-10-8(13)6-9(14)11(17-10)18-15/h6-7H,4-5,15H2,1-3H3,(H2,16,17,18) |
| InChIKey | KAMXNXPJILBPAX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|