C13H21N5O2 — CID 114407679
5-amino-6-[[1-(diethylamino)-1-oxopropan-2-yl]amino]pyridine-2-carboxamide (PubChem CID 114407679) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 5-amino-6-[[1-(diethylamino)-1-oxopropan-2-yl]amino]pyridine-2-carboxamide.
| Compound Name | 5-amino-6-[[1-(diethylamino)-1-oxopropan-2-yl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114407679 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 5-amino-6-[[1-(diethylamino)-1-oxopropan-2-yl]amino]pyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)C(C)Nc1nc(C(N)=O)ccc1N |
| InChI | InChI=1S/C13H21N5O2/c1-4-18(5-2)13(20)8(3)16-12-9(14)6-7-10(17-12)11(15)19/h6-8H,4-5,14H2,1-3H3,(H2,15,19)(H,16,17) |
| InChIKey | VSBLZUFMXIDWNW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |