C10H18N4OS — CID 103365099
2-[(3-amino-1,2-thiazol-5-yl)amino]-N,N-diethylpropanamide (PubChem CID 103365099) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is 2-[(3-amino-1,2-thiazol-5-yl)amino]-N,N-diethylpropanamide.
| Compound Name | 2-[(3-amino-1,2-thiazol-5-yl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 103365099 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[(3-amino-1,2-thiazol-5-yl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Nc1cc(N)ns1 |
| InChI | InChI=1S/C10H18N4OS/c1-4-14(5-2)10(15)7(3)12-9-6-8(11)13-16-9/h6-7,12H,4-5H2,1-3H3,(H2,11,13) |
| InChIKey | BXQUCFDXFNXINM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |