C9H16N4OS — CID 103365275
2-[(3-amino-1,2-thiazol-5-yl)amino]-N,N-diethylacetamide (PubChem CID 103365275) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-[(3-amino-1,2-thiazol-5-yl)amino]-N,N-diethylacetamide.
| Compound Name | 2-[(3-amino-1,2-thiazol-5-yl)amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 103365275 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-[(3-amino-1,2-thiazol-5-yl)amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNc1cc(N)ns1 |
| InChI | InChI=1S/C9H16N4OS/c1-3-13(4-2)9(14)6-11-8-5-7(10)12-15-8/h5,11H,3-4,6H2,1-2H3,(H2,10,12) |
| InChIKey | ZKDGKGAEUCBPQP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |