C11H17Cl2N5O — CID 102762537
2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylacetamide (PubChem CID 102762537) has the molecular formula C11H17Cl2N5O and a molecular weight of 306.20 g/mol. Its IUPAC name is 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylacetamide.
| Compound Name | 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 102762537 |
| Molecular Formula | C11H17Cl2N5O |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H17Cl2N5O/c1-3-18(4-2)9(19)6-15-10-7(12)5-8(13)11(16-10)17-14/h5H,3-4,6,14H2,1-2H3,(H2,15,16,17) |
| InChIKey | LUQDGFRFXVQXSZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|