C8H11Cl2N5O — CID 102761628
2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-methylamino]acetamide (PubChem CID 102761628) has the molecular formula C8H11Cl2N5O and a molecular weight of 264.12 g/mol. Its IUPAC name is 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-methylamino]acetamide.
| Compound Name | 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-methylamino]acetamide |
|---|---|
| PubChem CID | 102761628 |
| Molecular Formula | C8H11Cl2N5O |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-methylamino]acetamide |
| SMILES | CN(CC(N)=O)c1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H11Cl2N5O/c1-15(3-6(11)16)8-5(10)2-4(9)7(13-8)14-12/h2H,3,12H2,1H3,(H2,11,16)(H,13,14) |
| InChIKey | DGAUSCMLWOYUEJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|