C10H16Cl2N4O — CID 102761760
3,5-dichloro-6-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methylpyridin-2-amine (PubChem CID 102761760) has the molecular formula C10H16Cl2N4O and a molecular weight of 279.17 g/mol. Its IUPAC name is 3,5-dichloro-6-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 102761760 |
| Molecular Formula | C10H16Cl2N4O |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3,5-dichloro-6-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methylpyridin-2-amine |
| SMILES | COCC(C)N(C)c1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H16Cl2N4O/c1-6(5-17-3)16(2)10-8(12)4-7(11)9(14-10)15-13/h4,6H,5,13H2,1-3H3,(H,14,15) |
| InChIKey | CAHRIUXUBOQXCA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|