C9H16N6O3 — CID 80896203
6-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methyl-5-nitropyrimidin-4-amine (PubChem CID 80896203) has the molecular formula C9H16N6O3 and a molecular weight of 256.27 g/mol. Its IUPAC name is 6-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methyl-5-nitropyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80896203 |
| Molecular Formula | C9H16N6O3 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 6-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methyl-5-nitropyrimidin-4-amine |
| SMILES | COCC(C)N(C)c1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N6O3/c1-6(4-18-3)14(2)9-7(15(16)17)8(13-10)11-5-12-9/h5-6H,4,10H2,1-3H3,(H,11,12,13) |
| InChIKey | NJDQOIMJOYLQHA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|