C10H18N6O2S — CID 112668063
6-hydrazinyl-N-methyl-N-(1-methylsulfanylbutan-2-yl)-5-nitropyrimidin-4-amine (PubChem CID 112668063) has the molecular formula C10H18N6O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 6-hydrazinyl-N-methyl-N-(1-methylsulfanylbutan-2-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-methyl-N-(1-methylsulfanylbutan-2-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 112668063 |
| Molecular Formula | C10H18N6O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 6-hydrazinyl-N-methyl-N-(1-methylsulfanylbutan-2-yl)-5-nitropyrimidin-4-amine |
| SMILES | CCC(CSC)N(C)c1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H18N6O2S/c1-4-7(5-19-3)15(2)10-8(16(17)18)9(14-11)12-6-13-10/h6-7H,4-5,11H2,1-3H3,(H,12,13,14) |
| InChIKey | INRXKTDBZAXHAN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|