C9H16N6O2 — CID 80943828
N-ethyl-6-hydrazinyl-5-nitro-N-propylpyrimidin-4-amine (PubChem CID 80943828) has the molecular formula C9H16N6O2 and a molecular weight of 240.27 g/mol. Its IUPAC name is N-ethyl-6-hydrazinyl-5-nitro-N-propylpyrimidin-4-amine.
| Compound Name | N-ethyl-6-hydrazinyl-5-nitro-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80943828 |
| Molecular Formula | C9H16N6O2 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-ethyl-6-hydrazinyl-5-nitro-N-propylpyrimidin-4-amine |
| SMILES | CCCN(CC)c1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N6O2/c1-3-5-14(4-2)9-7(15(16)17)8(13-10)11-6-12-9/h6H,3-5,10H2,1-2H3,(H,11,12,13) |
| InChIKey | UUUUZUCVJMEVKB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|