C11H21N7O2 — CID 103192603
2-N-ethyl-2-N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine (PubChem CID 103192603) has the molecular formula C11H21N7O2 and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-N-ethyl-2-N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-ethyl-2-N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 103192603 |
| Molecular Formula | C11H21N7O2 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-N-ethyl-2-N-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine |
| SMILES | CCN(c1ncnc(NN)c1[N+](=O)[O-])C(C)CN(C)C |
| InChI | InChI=1S/C11H21N7O2/c1-5-17(8(2)6-16(3)4)11-9(18(19)20)10(15-12)13-7-14-11/h7-8H,5-6,12H2,1-4H3,(H,13,14,15) |
| InChIKey | ODVJBTAUSIESQQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|