C11H20N6O3 — CID 80905174
2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)-pentan-3-ylamino]ethanol (PubChem CID 80905174) has the molecular formula C11H20N6O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)-pentan-3-ylamino]ethanol.
| Compound Name | 2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)-pentan-3-ylamino]ethanol |
|---|---|
| PubChem CID | 80905174 |
| Molecular Formula | C11H20N6O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)-pentan-3-ylamino]ethanol |
| SMILES | CCC(CC)N(CCO)c1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H20N6O3/c1-3-8(4-2)16(5-6-18)11-9(17(19)20)10(15-12)13-7-14-11/h7-8,18H,3-6,12H2,1-2H3,(H,13,14,15) |
| InChIKey | JQOBDJYZLLESKA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|