C8H11N7O2 — CID 80916272
3-[(6-hydrazinyl-5-nitropyrimidin-4-yl)-methylamino]propanenitrile (PubChem CID 80916272) has the molecular formula C8H11N7O2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 3-[(6-hydrazinyl-5-nitropyrimidin-4-yl)-methylamino]propanenitrile.
| Compound Name | 3-[(6-hydrazinyl-5-nitropyrimidin-4-yl)-methylamino]propanenitrile |
|---|---|
| PubChem CID | 80916272 |
| Molecular Formula | C8H11N7O2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 3-[(6-hydrazinyl-5-nitropyrimidin-4-yl)-methylamino]propanenitrile |
| SMILES | CN(CCC#N)c1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N7O2/c1-14(4-2-3-9)8-6(15(16)17)7(13-10)11-5-12-8/h5H,2,4,10H2,1H3,(H,11,12,13) |
| InChIKey | XKIQRRLBQZKAJR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|