C12H18N6O2 — CID 80905890
N,N-bis(cyclopropylmethyl)-6-hydrazinyl-5-nitropyrimidin-4-amine (PubChem CID 80905890) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is N,N-bis(cyclopropylmethyl)-6-hydrazinyl-5-nitropyrimidin-4-amine.
| Compound Name | N,N-bis(cyclopropylmethyl)-6-hydrazinyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80905890 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N,N-bis(cyclopropylmethyl)-6-hydrazinyl-5-nitropyrimidin-4-amine |
| SMILES | NNc1ncnc(N(CC2CC2)CC2CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N6O2/c13-16-11-10(18(19)20)12(15-7-14-11)17(5-8-1-2-8)6-9-3-4-9/h7-9H,1-6,13H2,(H,14,15,16) |
| InChIKey | AHDARCXHBHYHEA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|