C11H19N5O2S — CID 115744805
4-N,6-N-dimethyl-4-N-(4-methylsulfanylbutan-2-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 115744805) has the molecular formula C11H19N5O2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-N,6-N-dimethyl-4-N-(4-methylsulfanylbutan-2-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-dimethyl-4-N-(4-methylsulfanylbutan-2-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115744805 |
| Molecular Formula | C11H19N5O2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4-N,6-N-dimethyl-4-N-(4-methylsulfanylbutan-2-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CNc1ncnc(N(C)C(C)CCSC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H19N5O2S/c1-8(5-6-19-4)15(3)11-9(16(17)18)10(12-2)13-7-14-11/h7-8H,5-6H2,1-4H3,(H,12,13,14) |
| InChIKey | XTDXHAAYEOQZSK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|