C11H21N5 — CID 80905747
6-hydrazinyl-N,5-dimethyl-N-pentan-3-ylpyrimidin-4-amine (PubChem CID 80905747) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 6-hydrazinyl-N,5-dimethyl-N-pentan-3-ylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N,5-dimethyl-N-pentan-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80905747 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 6-hydrazinyl-N,5-dimethyl-N-pentan-3-ylpyrimidin-4-amine |
| SMILES | CCC(CC)N(C)c1ncnc(NN)c1C |
| InChI | InChI=1S/C11H21N5/c1-5-9(6-2)16(4)11-8(3)10(15-12)13-7-14-11/h7,9H,5-6,12H2,1-4H3,(H,13,14,15) |
| InChIKey | LNTJIDZGPSLCFV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|