C13H17N5 — CID 80917919
N-benzyl-6-hydrazinyl-N,5-dimethylpyrimidin-4-amine (PubChem CID 80917919) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-benzyl-6-hydrazinyl-N,5-dimethylpyrimidin-4-amine.
| Compound Name | N-benzyl-6-hydrazinyl-N,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80917919 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N-benzyl-6-hydrazinyl-N,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1c(NN)ncnc1N(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H17N5/c1-10-12(17-14)15-9-16-13(10)18(2)8-11-6-4-3-5-7-11/h3-7,9H,8,14H2,1-2H3,(H,15,16,17) |
| InChIKey | UZIMZELKBGWMBI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|