C15H21N5 — CID 22539506
4-N-benzyl-4-N-methyl-6-N-propylpyrimidine-4,5,6-triamine (PubChem CID 22539506) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 4-N-benzyl-4-N-methyl-6-N-propylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-benzyl-4-N-methyl-6-N-propylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22539506 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 4-N-benzyl-4-N-methyl-6-N-propylpyrimidine-4,5,6-triamine |
| SMILES | CCCNc1ncnc(N(C)Cc2ccccc2)c1N |
| InChI | InChI=1S/C15H21N5/c1-3-9-17-14-13(16)15(19-11-18-14)20(2)10-12-7-5-4-6-8-12/h4-8,11H,3,9-10,16H2,1-2H3,(H,17,18,19) |
| InChIKey | WANBFOKECQBORX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |