C17H17ClN6 — CID 22539688
4-N-benzyl-6-N-(2-chloro-3-pyridinyl)-4-N-methylpyrimidine-4,5,6-triamine (PubChem CID 22539688) has the molecular formula C17H17ClN6 and a molecular weight of 340.82 g/mol. Its IUPAC name is 4-N-benzyl-6-N-(2-chloro-3-pyridinyl)-4-N-methylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-benzyl-6-N-(2-chloro-3-pyridinyl)-4-N-methylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22539688 |
| Molecular Formula | C17H17ClN6 |
| Molecular Weight | 340.82 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-N-benzyl-6-N-(2-chloro-3-pyridinyl)-4-N-methylpyrimidine-4,5,6-triamine |
| SMILES | CN(Cc1ccccc1)c1ncnc(Nc2cccnc2Cl)c1N |
| InChI | InChI=1S/C17H17ClN6/c1-24(10-12-6-3-2-4-7-12)17-14(19)16(21-11-22-17)23-13-8-5-9-20-15(13)18/h2-9,11H,10,19H2,1H3,(H,21,22,23) |
| InChIKey | NZNMJLWFBYHPQJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|