C17H25ClN6 — CID 19141069
6-N-(2-chloro-3-pyridinyl)-4-N,4-N-bis(2-methylpropyl)pyrimidine-4,5,6-triamine (PubChem CID 19141069) has the molecular formula C17H25ClN6 and a molecular weight of 348.88 g/mol. Its IUPAC name is 6-N-(2-chloro-3-pyridinyl)-4-N,4-N-bis(2-methylpropyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(2-chloro-3-pyridinyl)-4-N,4-N-bis(2-methylpropyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19141069 |
| Molecular Formula | C17H25ClN6 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 6-N-(2-chloro-3-pyridinyl)-4-N,4-N-bis(2-methylpropyl)pyrimidine-4,5,6-triamine |
| SMILES | CC(C)CN(CC(C)C)c1ncnc(Nc2cccnc2Cl)c1N |
| InChI | InChI=1S/C17H25ClN6/c1-11(2)8-24(9-12(3)4)17-14(19)16(21-10-22-17)23-13-6-5-7-20-15(13)18/h5-7,10-12H,8-9,19H2,1-4H3,(H,21,22,23) |
| InChIKey | LRADEYQCTGVQMF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|